About 3,7-dimethyl-1-[2-(4-oxocyclohexyl)ethyl]indole-2,6-dione
3,7-dimethyl-1-[2-(4-oxocyclohexyl)ethyl]indole-2,6-dione (PubChem CID 151102377) has the molecular formula C18H21NO3
and a molecular weight of 299.37 g/mol. Its IUPAC name is 3,7-dimethyl-1-[2-(4-oxocyclohexyl)ethyl]indole-2,6-dione.
Molecular Properties
| Compound Name | 3,7-dimethyl-1-[2-(4-oxocyclohexyl)ethyl]indole-2,6-dione |
| PubChem CID | 151102377 |
| Molecular Formula | C18H21NO3 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | 3,7-dimethyl-1-[2-(4-oxocyclohexyl)ethyl]indole-2,6-dione |
| SMILES | CC1=C2C=CC(=O)C(C)=C2N(CCC2CCC(=O)CC2)C1=O |
| InChI | InChI=1S/C18H21NO3/c1-11-15-7-8-16(21)12(2)17(15)19(18(11)22)10-9-13-3-5-14(20)6-4-13/h7-8,13H,3-6,9-10H2,1-2H3 |
| InChIKey | MOJYUBYVUVPKEC-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,7-dimethyl-1-[2-(4-oxocyclohexyl)ethyl]indole-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,7-dimethyl-1-[2-(4-oxocyclohexyl)ethyl]indole-2,6-dione?
The IUPAC name of 3,7-dimethyl-1-[2-(4-oxocyclohexyl)ethyl]indole-2,6-dione (CID 151102377) is 3,7-dimethyl-1-[2-(4-oxocyclohexyl)ethyl]indole-2,6-dione.
What is the SMILES notation for 3,7-dimethyl-1-[2-(4-oxocyclohexyl)ethyl]indole-2,6-dione?
The canonical SMILES for 3,7-dimethyl-1-[2-(4-oxocyclohexyl)ethyl]indole-2,6-dione is CC1=C2C=CC(=O)C(C)=C2N(CCC2CCC(=O)CC2)C1=O.
What is the InChIKey of 3,7-dimethyl-1-[2-(4-oxocyclohexyl)ethyl]indole-2,6-dione?
The InChIKey is MOJYUBYVUVPKEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21NO3/c1-11-15-7-8-16(21)12(2)17(15)19(18(11)22)10-9-13-3-5-14(20)6-4-13/h7-8,13H,3-6,9-10H2,1-2H3.
What are the key properties of 3,7-dimethyl-1-[2-(4-oxocyclohexyl)ethyl]indole-2,6-dione?
3,7-dimethyl-1-[2-(4-oxocyclohexyl)ethyl]indole-2,6-dione has a molecular weight of 299.37 g/mol, XLogP of 2.71, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,7-dimethyl-1-[2-(4-oxocyclohexyl)ethyl]indole-2,6-dione is sourced from PubChem (CID 151102377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).