About (4-nitrophenyl) 2-propyloctanoate
(4-nitrophenyl) 2-propyloctanoate (PubChem CID 151106755) has the molecular formula C17H25NO4
and a molecular weight of 307.39 g/mol. Its IUPAC name is (4-nitrophenyl) 2-propyloctanoate.
Molecular Properties
| Compound Name | (4-nitrophenyl) 2-propyloctanoate |
| PubChem CID | 151106755 |
| Molecular Formula | C17H25NO4 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | (4-nitrophenyl) 2-propyloctanoate |
| SMILES | CCCCCCC(CCC)C(=O)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H25NO4/c1-3-5-6-7-9-14(8-4-2)17(19)22-16-12-10-15(11-13-16)18(20)21/h10-14H,3-9H2,1-2H3 |
| InChIKey | MPGPDKHMCRJJFW-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-nitrophenyl) 2-propyloctanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-nitrophenyl) 2-propyloctanoate?
The IUPAC name of (4-nitrophenyl) 2-propyloctanoate (CID 151106755) is (4-nitrophenyl) 2-propyloctanoate.
What is the SMILES notation for (4-nitrophenyl) 2-propyloctanoate?
The canonical SMILES for (4-nitrophenyl) 2-propyloctanoate is CCCCCCC(CCC)C(=O)Oc1ccc([N+](=O)[O-])cc1.
What is the InChIKey of (4-nitrophenyl) 2-propyloctanoate?
The InChIKey is MPGPDKHMCRJJFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25NO4/c1-3-5-6-7-9-14(8-4-2)17(19)22-16-12-10-15(11-13-16)18(20)21/h10-14H,3-9H2,1-2H3.
What are the key properties of (4-nitrophenyl) 2-propyloctanoate?
(4-nitrophenyl) 2-propyloctanoate has a molecular weight of 307.39 g/mol, XLogP of 4.89, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-nitrophenyl) 2-propyloctanoate is sourced from PubChem (CID 151106755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).