About 4-[6-[2-(2,3-dihydro-1-benzothiophen-5-yl)ethylamino]pyrimidin-4-yl]-2-methylsulfanylbenzoic acid
4-[6-[2-(2,3-dihydro-1-benzothiophen-5-yl)ethylamino]pyrimidin-4-yl]-2-methylsulfanylbenzoic acid (PubChem CID 151106810) has the molecular formula C22H21N3O2S2
and a molecular weight of 423.56 g/mol. Its IUPAC name is 4-[6-[2-(2,3-dihydro-1-benzothiophen-5-yl)ethylamino]pyrimidin-4-yl]-2-methylsulfanylbenzoic acid.
Molecular Properties
| Compound Name | 4-[6-[2-(2,3-dihydro-1-benzothiophen-5-yl)ethylamino]pyrimidin-4-yl]-2-methylsulfanylbenzoic acid |
| PubChem CID | 151106810 |
| Molecular Formula | C22H21N3O2S2 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | 4-[6-[2-(2,3-dihydro-1-benzothiophen-5-yl)ethylamino]pyrimidin-4-yl]-2-methylsulfanylbenzoic acid |
| SMILES | CSc1cc(-c2cc(NCCc3ccc4c(c3)CCS4)ncn2)ccc1C(=O)O |
| InChI | InChI=1S/C22H21N3O2S2/c1-28-20-11-15(3-4-17(20)22(26)27)18-12-21(25-13-24-18)23-8-6-14-2-5-19-16(10-14)7-9-29-19/h2-5,10-13H,6-9H2,1H3,(H,26,27)(H,23,24,25) |
| InChIKey | MPGXNJDPZUVONC-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[6-[2-(2,3-dihydro-1-benzothiophen-5-yl)ethylamino]pyrimidin-4-yl]-2-methylsulfanylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[6-[2-(2,3-dihydro-1-benzothiophen-5-yl)ethylamino]pyrimidin-4-yl]-2-methylsulfanylbenzoic acid?
The IUPAC name of 4-[6-[2-(2,3-dihydro-1-benzothiophen-5-yl)ethylamino]pyrimidin-4-yl]-2-methylsulfanylbenzoic acid (CID 151106810) is 4-[6-[2-(2,3-dihydro-1-benzothiophen-5-yl)ethylamino]pyrimidin-4-yl]-2-methylsulfanylbenzoic acid.
What is the SMILES notation for 4-[6-[2-(2,3-dihydro-1-benzothiophen-5-yl)ethylamino]pyrimidin-4-yl]-2-methylsulfanylbenzoic acid?
The canonical SMILES for 4-[6-[2-(2,3-dihydro-1-benzothiophen-5-yl)ethylamino]pyrimidin-4-yl]-2-methylsulfanylbenzoic acid is CSc1cc(-c2cc(NCCc3ccc4c(c3)CCS4)ncn2)ccc1C(=O)O.
What is the InChIKey of 4-[6-[2-(2,3-dihydro-1-benzothiophen-5-yl)ethylamino]pyrimidin-4-yl]-2-methylsulfanylbenzoic acid?
The InChIKey is MPGXNJDPZUVONC-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21N3O2S2/c1-28-20-11-15(3-4-17(20)22(26)27)18-12-21(25-13-24-18)23-8-6-14-2-5-19-16(10-14)7-9-29-19/h2-5,10-13H,6-9H2,1H3,(H,26,27)(H,23,24,25).
What are the key properties of 4-[6-[2-(2,3-dihydro-1-benzothiophen-5-yl)ethylamino]pyrimidin-4-yl]-2-methylsulfanylbenzoic acid?
4-[6-[2-(2,3-dihydro-1-benzothiophen-5-yl)ethylamino]pyrimidin-4-yl]-2-methylsulfanylbenzoic acid has a molecular weight of 423.56 g/mol, XLogP of 4.87, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[6-[2-(2,3-dihydro-1-benzothiophen-5-yl)ethylamino]pyrimidin-4-yl]-2-methylsulfanylbenzoic acid is sourced from PubChem (CID 151106810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).