About methyl 1,1-dioxobenzo[f][1,2]benzothiazole-3-carboxylate
methyl 1,1-dioxobenzo[f][1,2]benzothiazole-3-carboxylate (PubChem CID 151107868) has the molecular formula C13H9NO4S
and a molecular weight of 275.29 g/mol. Its IUPAC name is methyl 1,1-dioxobenzo[f][1,2]benzothiazole-3-carboxylate.
Molecular Properties
| Compound Name | methyl 1,1-dioxobenzo[f][1,2]benzothiazole-3-carboxylate |
| PubChem CID | 151107868 |
| Molecular Formula | C13H9NO4S |
| Molecular Weight | 275.29 g/mol |
| Exact Mass | 275.03 |
| IUPAC Name | methyl 1,1-dioxobenzo[f][1,2]benzothiazole-3-carboxylate |
| SMILES | COC(=O)C1=NS(=O)(=O)c2cc3ccccc3cc21 |
| InChI | InChI=1S/C13H9NO4S/c1-18-13(15)12-10-6-8-4-2-3-5-9(8)7-11(10)19(16,17)14-12/h2-7H,1H3 |
| InChIKey | MPMIGGYVGKPZCX-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 72.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.29 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 1,1-dioxobenzo[f][1,2]benzothiazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1,1-dioxobenzo[f][1,2]benzothiazole-3-carboxylate?
The IUPAC name of methyl 1,1-dioxobenzo[f][1,2]benzothiazole-3-carboxylate (CID 151107868) is methyl 1,1-dioxobenzo[f][1,2]benzothiazole-3-carboxylate.
What is the SMILES notation for methyl 1,1-dioxobenzo[f][1,2]benzothiazole-3-carboxylate?
The canonical SMILES for methyl 1,1-dioxobenzo[f][1,2]benzothiazole-3-carboxylate is COC(=O)C1=NS(=O)(=O)c2cc3ccccc3cc21.
What is the InChIKey of methyl 1,1-dioxobenzo[f][1,2]benzothiazole-3-carboxylate?
The InChIKey is MPMIGGYVGKPZCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9NO4S/c1-18-13(15)12-10-6-8-4-2-3-5-9(8)7-11(10)19(16,17)14-12/h2-7H,1H3.
What are the key properties of methyl 1,1-dioxobenzo[f][1,2]benzothiazole-3-carboxylate?
methyl 1,1-dioxobenzo[f][1,2]benzothiazole-3-carboxylate has a molecular weight of 275.29 g/mol, XLogP of 1.50, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1,1-dioxobenzo[f][1,2]benzothiazole-3-carboxylate is sourced from PubChem (CID 151107868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).