C8H6Cl2F10O — CID 151109419
4-chloro-2-(4-chloro-1,1,1,3,3-pentafluorobutan-2-yl)oxy-1,1,1,3,3-pentafluorobutane (PubChem CID 151109419) has the molecular formula C8H6Cl2F10O and a molecular weight of 379.02 g/mol. Its IUPAC name is 4-chloro-2-(4-chloro-1,1,1,3,3-pentafluorobutan-2-yl)oxy-1,1,1,3,3-pentafluorobutane.
| Compound Name | 4-chloro-2-(4-chloro-1,1,1,3,3-pentafluorobutan-2-yl)oxy-1,1,1,3,3-pentafluorobutane |
|---|---|
| PubChem CID | 151109419 |
| Molecular Formula | C8H6Cl2F10O |
| Molecular Weight | 379.02 g/mol |
| Exact Mass | 377.96 |
| IUPAC Name | 4-chloro-2-(4-chloro-1,1,1,3,3-pentafluorobutan-2-yl)oxy-1,1,1,3,3-pentafluorobutane |
| SMILES | FC(F)(F)C(OC(C(F)(F)F)C(F)(F)CCl)C(F)(F)CCl |
| InChI | InChI=1S/C8H6Cl2F10O/c9-1-5(11,12)3(7(15,16)17)21-4(8(18,19)20)6(13,14)2-10/h3-4H,1-2H2 |
| InChIKey | MPUOMQIWMPWPBB-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.02 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|