C19H21NO — CID 15111052
5-phenyl-3-prop-2-enyl-1,2,4,5-tetrahydro-3-benzazepin-7-ol (PubChem CID 15111052) has the molecular formula C19H21NO and a molecular weight of 279.38 g/mol. Its IUPAC name is 5-phenyl-3-prop-2-enyl-1,2,4,5-tetrahydro-3-benzazepin-7-ol.
| Compound Name | 5-phenyl-3-prop-2-enyl-1,2,4,5-tetrahydro-3-benzazepin-7-ol |
|---|---|
| PubChem CID | 15111052 |
| Molecular Formula | C19H21NO |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 5-phenyl-3-prop-2-enyl-1,2,4,5-tetrahydro-3-benzazepin-7-ol |
| SMILES | C=CCN1CCc2ccc(O)cc2C(c2ccccc2)C1 |
| InChI | InChI=1S/C19H21NO/c1-2-11-20-12-10-16-8-9-17(21)13-18(16)19(14-20)15-6-4-3-5-7-15/h2-9,13,19,21H,1,10-12,14H2 |
| InChIKey | FLGIMBZCSIRTIL-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|