C22H23N3O8 — CID 15111248
dimethyl 4-(3-ethoxycarbonyl-1-oxido-4-oxoquinoxalin-4-ium-2-yl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 15111248) has the molecular formula C22H23N3O8 and a molecular weight of 457.44 g/mol. Its IUPAC name is dimethyl 4-(3-ethoxycarbonyl-1-oxido-4-oxoquinoxalin-4-ium-2-yl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | dimethyl 4-(3-ethoxycarbonyl-1-oxido-4-oxoquinoxalin-4-ium-2-yl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 15111248 |
| Molecular Formula | C22H23N3O8 |
| Molecular Weight | 457.44 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | dimethyl 4-(3-ethoxycarbonyl-1-oxido-4-oxoquinoxalin-4-ium-2-yl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)c1c(C2C(C(=O)OC)=C(C)NC(C)=C2C(=O)OC)n([O-])c2ccccc2[n+]1=O |
| InChI | InChI=1S/C22H23N3O8/c1-6-33-22(28)19-18(24(29)13-9-7-8-10-14(13)25(19)30)17-15(20(26)31-4)11(2)23-12(3)16(17)21(27)32-5/h7-10,17,23H,6H2,1-5H3 |
| InChIKey | BWVIXDDWVOHFAA-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 141.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.44 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|