C8H11N5 — CID 15111261
3-(1,4,5,6-tetrahydropyrimidin-2-yl)pyrazin-2-amine (PubChem CID 15111261) has the molecular formula C8H11N5 and a molecular weight of 177.21 g/mol. Its IUPAC name is 3-(1,4,5,6-tetrahydropyrimidin-2-yl)pyrazin-2-amine.
| Compound Name | 3-(1,4,5,6-tetrahydropyrimidin-2-yl)pyrazin-2-amine |
|---|---|
| PubChem CID | 15111261 |
| Molecular Formula | C8H11N5 |
| Molecular Weight | 177.21 g/mol |
| Exact Mass | 177.10 |
| IUPAC Name | 3-(1,4,5,6-tetrahydropyrimidin-2-yl)pyrazin-2-amine |
| SMILES | Nc1nccnc1C1=NCCCN1 |
| InChI | InChI=1S/C8H11N5/c9-7-6(10-4-5-11-7)8-12-2-1-3-13-8/h4-5H,1-3H2,(H2,9,11)(H,12,13) |
| InChIKey | ASFXAOQOSYJPTB-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.21 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |