About 2-(1-methylcyclohexa-2,4-dien-1-yl)-2,3-dihydro-1-benzofuran
2-(1-methylcyclohexa-2,4-dien-1-yl)-2,3-dihydro-1-benzofuran (PubChem CID 151112677) has the molecular formula C15H16O
and a molecular weight of 212.29 g/mol. Its IUPAC name is 2-(1-methylcyclohexa-2,4-dien-1-yl)-2,3-dihydro-1-benzofuran.
Molecular Properties
| Compound Name | 2-(1-methylcyclohexa-2,4-dien-1-yl)-2,3-dihydro-1-benzofuran |
| PubChem CID | 151112677 |
| Molecular Formula | C15H16O |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | 2-(1-methylcyclohexa-2,4-dien-1-yl)-2,3-dihydro-1-benzofuran |
| SMILES | CC1(C2Cc3ccccc3O2)C=CC=CC1 |
| InChI | InChI=1S/C15H16O/c1-15(9-5-2-6-10-15)14-11-12-7-3-4-8-13(12)16-14/h2-9,14H,10-11H2,1H3 |
| InChIKey | MQLZPSBHPUVTBB-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(1-methylcyclohexa-2,4-dien-1-yl)-2,3-dihydro-1-benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-methylcyclohexa-2,4-dien-1-yl)-2,3-dihydro-1-benzofuran?
The IUPAC name of 2-(1-methylcyclohexa-2,4-dien-1-yl)-2,3-dihydro-1-benzofuran (CID 151112677) is 2-(1-methylcyclohexa-2,4-dien-1-yl)-2,3-dihydro-1-benzofuran.
What is the SMILES notation for 2-(1-methylcyclohexa-2,4-dien-1-yl)-2,3-dihydro-1-benzofuran?
The canonical SMILES for 2-(1-methylcyclohexa-2,4-dien-1-yl)-2,3-dihydro-1-benzofuran is CC1(C2Cc3ccccc3O2)C=CC=CC1.
What is the InChIKey of 2-(1-methylcyclohexa-2,4-dien-1-yl)-2,3-dihydro-1-benzofuran?
The InChIKey is MQLZPSBHPUVTBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16O/c1-15(9-5-2-6-10-15)14-11-12-7-3-4-8-13(12)16-14/h2-9,14H,10-11H2,1H3.
What are the key properties of 2-(1-methylcyclohexa-2,4-dien-1-yl)-2,3-dihydro-1-benzofuran?
2-(1-methylcyclohexa-2,4-dien-1-yl)-2,3-dihydro-1-benzofuran has a molecular weight of 212.29 g/mol, XLogP of 3.51, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-methylcyclohexa-2,4-dien-1-yl)-2,3-dihydro-1-benzofuran is sourced from PubChem (CID 151112677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).