About [(8-chloro-1-fluoro-2,3-dihydroquinolin-4-ylidene)amino]thiourea
[(8-chloro-1-fluoro-2,3-dihydroquinolin-4-ylidene)amino]thiourea (PubChem CID 151112825) has the molecular formula C10H10ClFN4S
and a molecular weight of 272.74 g/mol. Its IUPAC name is [(8-chloro-1-fluoro-2,3-dihydroquinolin-4-ylidene)amino]thiourea.
Molecular Properties
| Compound Name | [(8-chloro-1-fluoro-2,3-dihydroquinolin-4-ylidene)amino]thiourea |
| PubChem CID | 151112825 |
| Molecular Formula | C10H10ClFN4S |
| Molecular Weight | 272.74 g/mol |
| Exact Mass | 272.03 |
| IUPAC Name | [(8-chloro-1-fluoro-2,3-dihydroquinolin-4-ylidene)amino]thiourea |
| SMILES | NC(=S)NN=C1CCN(F)c2c(Cl)cccc21 |
| InChI | InChI=1S/C10H10ClFN4S/c11-7-3-1-2-6-8(14-15-10(13)17)4-5-16(12)9(6)7/h1-3H,4-5H2,(H3,13,15,17) |
| InChIKey | MQMWVHQBCUMSKL-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.74 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [(8-chloro-1-fluoro-2,3-dihydroquinolin-4-ylidene)amino]thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(8-chloro-1-fluoro-2,3-dihydroquinolin-4-ylidene)amino]thiourea?
The IUPAC name of [(8-chloro-1-fluoro-2,3-dihydroquinolin-4-ylidene)amino]thiourea (CID 151112825) is [(8-chloro-1-fluoro-2,3-dihydroquinolin-4-ylidene)amino]thiourea.
What is the SMILES notation for [(8-chloro-1-fluoro-2,3-dihydroquinolin-4-ylidene)amino]thiourea?
The canonical SMILES for [(8-chloro-1-fluoro-2,3-dihydroquinolin-4-ylidene)amino]thiourea is NC(=S)NN=C1CCN(F)c2c(Cl)cccc21.
What is the InChIKey of [(8-chloro-1-fluoro-2,3-dihydroquinolin-4-ylidene)amino]thiourea?
The InChIKey is MQMWVHQBCUMSKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10ClFN4S/c11-7-3-1-2-6-8(14-15-10(13)17)4-5-16(12)9(6)7/h1-3H,4-5H2,(H3,13,15,17).
What are the key properties of [(8-chloro-1-fluoro-2,3-dihydroquinolin-4-ylidene)amino]thiourea?
[(8-chloro-1-fluoro-2,3-dihydroquinolin-4-ylidene)amino]thiourea has a molecular weight of 272.74 g/mol, XLogP of 1.97, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(8-chloro-1-fluoro-2,3-dihydroquinolin-4-ylidene)amino]thiourea is sourced from PubChem (CID 151112825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).