C15H14ClN3O4S — CID 151113333
[(4R)-2-[5-(chloromethyl)-7-nitro-1H-indol-2-yl]-4,5-dihydro-1,3-thiazol-4-yl]methyl acetate (PubChem CID 151113333) has the molecular formula C15H14ClN3O4S and a molecular weight of 367.81 g/mol. Its IUPAC name is [(4R)-2-[5-(chloromethyl)-7-nitro-1H-indol-2-yl]-4,5-dihydro-1,3-thiazol-4-yl]methyl acetate.
| Compound Name | [(4R)-2-[5-(chloromethyl)-7-nitro-1H-indol-2-yl]-4,5-dihydro-1,3-thiazol-4-yl]methyl acetate |
|---|---|
| PubChem CID | 151113333 |
| Molecular Formula | C15H14ClN3O4S |
| Molecular Weight | 367.81 g/mol |
| Exact Mass | 367.04 |
| IUPAC Name | [(4R)-2-[5-(chloromethyl)-7-nitro-1H-indol-2-yl]-4,5-dihydro-1,3-thiazol-4-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1CSC(c2cc3cc(CCl)cc([N+](=O)[O-])c3[nH]2)=N1 |
| InChI | InChI=1S/C15H14ClN3O4S/c1-8(20)23-6-11-7-24-15(17-11)12-4-10-2-9(5-16)3-13(19(21)22)14(10)18-12/h2-4,11,18H,5-7H2,1H3/t11-/m1/s1 |
| InChIKey | MQPVQVCQXAOBCF-LLVKDONJSA-N |
| XLogP | 3.24 |
| TPSA | 97.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.81 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|