About 2-pentyl-6-propyl-1,3-oxathiane
2-pentyl-6-propyl-1,3-oxathiane (PubChem CID 151113746) has the molecular formula C12H24OS
and a molecular weight of 216.39 g/mol. Its IUPAC name is 2-pentyl-6-propyl-1,3-oxathiane.
Molecular Properties
| Compound Name | 2-pentyl-6-propyl-1,3-oxathiane |
| PubChem CID | 151113746 |
| Molecular Formula | C12H24OS |
| Molecular Weight | 216.39 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | 2-pentyl-6-propyl-1,3-oxathiane |
| SMILES | CCCCCC1OC(CCC)CCS1 |
| InChI | InChI=1S/C12H24OS/c1-3-5-6-8-12-13-11(7-4-2)9-10-14-12/h11-12H,3-10H2,1-2H3 |
| InChIKey | MQSABSDCDRVLOS-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.39 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-pentyl-6-propyl-1,3-oxathiane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pentyl-6-propyl-1,3-oxathiane?
The IUPAC name of 2-pentyl-6-propyl-1,3-oxathiane (CID 151113746) is 2-pentyl-6-propyl-1,3-oxathiane.
What is the SMILES notation for 2-pentyl-6-propyl-1,3-oxathiane?
The canonical SMILES for 2-pentyl-6-propyl-1,3-oxathiane is CCCCCC1OC(CCC)CCS1.
What is the InChIKey of 2-pentyl-6-propyl-1,3-oxathiane?
The InChIKey is MQSABSDCDRVLOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24OS/c1-3-5-6-8-12-13-11(7-4-2)9-10-14-12/h11-12H,3-10H2,1-2H3.
What are the key properties of 2-pentyl-6-propyl-1,3-oxathiane?
2-pentyl-6-propyl-1,3-oxathiane has a molecular weight of 216.39 g/mol, XLogP of 4.22, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pentyl-6-propyl-1,3-oxathiane is sourced from PubChem (CID 151113746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).