C11H14Cl2N2O3 — CID 151113956
2,2-dichloro-N-[5-(furan-2-yl)-2,2-dimethyl-1,3-oxazolidin-3-yl]acetamide (PubChem CID 151113956) has the molecular formula C11H14Cl2N2O3 and a molecular weight of 293.15 g/mol. Its IUPAC name is 2,2-dichloro-N-[5-(furan-2-yl)-2,2-dimethyl-1,3-oxazolidin-3-yl]acetamide.
| Compound Name | 2,2-dichloro-N-[5-(furan-2-yl)-2,2-dimethyl-1,3-oxazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 151113956 |
| Molecular Formula | C11H14Cl2N2O3 |
| Molecular Weight | 293.15 g/mol |
| Exact Mass | 292.04 |
| IUPAC Name | 2,2-dichloro-N-[5-(furan-2-yl)-2,2-dimethyl-1,3-oxazolidin-3-yl]acetamide |
| SMILES | CC1(C)OC(c2ccco2)CN1NC(=O)C(Cl)Cl |
| InChI | InChI=1S/C11H14Cl2N2O3/c1-11(2)15(14-10(16)9(12)13)6-8(18-11)7-4-3-5-17-7/h3-5,8-9H,6H2,1-2H3,(H,14,16) |
| InChIKey | MQTGCWKTAQJOLL-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.15 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|