C14H15N3O2Se — CID 15111563
5-(3,3-dimethyl-2-oxo-1H-indol-5-yl)-6-methyl-3,6-dihydro-1,3,4-selenadiazin-2-one (PubChem CID 15111563) has the molecular formula C14H15N3O2Se and a molecular weight of 336.25 g/mol. Its IUPAC name is 5-(3,3-dimethyl-2-oxo-1H-indol-5-yl)-6-methyl-3,6-dihydro-1,3,4-selenadiazin-2-one.
| Compound Name | 5-(3,3-dimethyl-2-oxo-1H-indol-5-yl)-6-methyl-3,6-dihydro-1,3,4-selenadiazin-2-one |
|---|---|
| PubChem CID | 15111563 |
| Molecular Formula | C14H15N3O2Se |
| Molecular Weight | 336.25 g/mol |
| Exact Mass | 337.03 |
| IUPAC Name | 5-(3,3-dimethyl-2-oxo-1H-indol-5-yl)-6-methyl-3,6-dihydro-1,3,4-selenadiazin-2-one |
| SMILES | CC1[Se]C(=O)NN=C1c1ccc2c(c1)C(C)(C)C(=O)N2 |
| InChI | InChI=1S/C14H15N3O2Se/c1-7-11(16-17-13(19)20-7)8-4-5-10-9(6-8)14(2,3)12(18)15-10/h4-7H,1-3H3,(H,15,18)(H,17,19) |
| InChIKey | JIEALIYCFQREEA-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.25 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|