C18H26NO9P — CID 15111666
(3aR,5S,6R,6aR)-5-(1-dimethoxyphosphoryl-2-nitroethyl)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole (PubChem CID 15111666) has the molecular formula C18H26NO9P and a molecular weight of 431.38 g/mol. Its IUPAC name is (3aR,5S,6R,6aR)-5-(1-dimethoxyphosphoryl-2-nitroethyl)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole.
| Compound Name | (3aR,5S,6R,6aR)-5-(1-dimethoxyphosphoryl-2-nitroethyl)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
|---|---|
| PubChem CID | 15111666 |
| Molecular Formula | C18H26NO9P |
| Molecular Weight | 431.38 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | (3aR,5S,6R,6aR)-5-(1-dimethoxyphosphoryl-2-nitroethyl)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
| SMILES | COP(=O)(OC)C(C[N+](=O)[O-])[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C18H26NO9P/c1-18(2)27-16-15(25-11-12-8-6-5-7-9-12)14(26-17(16)28-18)13(10-19(20)21)29(22,23-3)24-4/h5-9,13-17H,10-11H2,1-4H3/t13?,14-,15+,16-,17-/m1/s1 |
| InChIKey | JIEJFZVZBQVTMT-SLUKUZTOSA-N |
| XLogP | 2.58 |
| TPSA | 115.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.38 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|