About 4-bromo-2,7-ditert-butylpyrene
4-bromo-2,7-ditert-butylpyrene (PubChem CID 15111850) has the molecular formula C24H25Br
and a molecular weight of 393.37 g/mol. Its IUPAC name is 4-bromo-2,7-ditert-butylpyrene.
Molecular Properties
| Compound Name | 4-bromo-2,7-ditert-butylpyrene |
| PubChem CID | 15111850 |
| Molecular Formula | C24H25Br |
| Molecular Weight | 393.37 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | 4-bromo-2,7-ditert-butylpyrene |
| SMILES | CC(C)(C)c1cc2ccc3cc(C(C)(C)C)cc4c(Br)cc(c1)c2c34 |
| InChI | InChI=1S/C24H25Br/c1-23(2,3)17-9-14-7-8-15-10-18(24(4,5)6)13-19-20(25)12-16(11-17)21(14)22(15)19/h7-13H,1-6H3 |
| InChIKey | XWUKXXMOPHRTRY-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 393.37 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-2,7-ditert-butylpyrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-2,7-ditert-butylpyrene?
The IUPAC name of 4-bromo-2,7-ditert-butylpyrene (CID 15111850) is 4-bromo-2,7-ditert-butylpyrene.
What is the SMILES notation for 4-bromo-2,7-ditert-butylpyrene?
The canonical SMILES for 4-bromo-2,7-ditert-butylpyrene is CC(C)(C)c1cc2ccc3cc(C(C)(C)C)cc4c(Br)cc(c1)c2c34.
What is the InChIKey of 4-bromo-2,7-ditert-butylpyrene?
The InChIKey is XWUKXXMOPHRTRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H25Br/c1-23(2,3)17-9-14-7-8-15-10-18(24(4,5)6)13-19-20(25)12-16(11-17)21(14)22(15)19/h7-13H,1-6H3.
What are the key properties of 4-bromo-2,7-ditert-butylpyrene?
4-bromo-2,7-ditert-butylpyrene has a molecular weight of 393.37 g/mol, XLogP of 7.94, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-2,7-ditert-butylpyrene is sourced from PubChem (CID 15111850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).