C14H22BNO — CID 151120676
4-methyl-3-(4,4,5,5-tetramethyloxaborolan-2-yl)aniline (PubChem CID 151120676) has the molecular formula C14H22BNO and a molecular weight of 231.15 g/mol. Its IUPAC name is 4-methyl-3-(4,4,5,5-tetramethyloxaborolan-2-yl)aniline.
| Compound Name | 4-methyl-3-(4,4,5,5-tetramethyloxaborolan-2-yl)aniline |
|---|---|
| PubChem CID | 151120676 |
| Molecular Formula | C14H22BNO |
| Molecular Weight | 231.15 g/mol |
| Exact Mass | 231.18 |
| IUPAC Name | 4-methyl-3-(4,4,5,5-tetramethyloxaborolan-2-yl)aniline |
| SMILES | Cc1ccc(N)cc1B1CC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C14H22BNO/c1-10-6-7-11(16)8-12(10)15-9-13(2,3)14(4,5)17-15/h6-8H,9,16H2,1-5H3 |
| InChIKey | MSCRDUWFZLEVER-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.15 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|