C10H18N2O — CID 15112124
(3aR,7aS)-N,N,3a-trimethyl-5,6,7,7a-tetrahydro-4H-1,3-benzoxazol-2-amine (PubChem CID 15112124) has the molecular formula C10H18N2O and a molecular weight of 182.27 g/mol. Its IUPAC name is (3aR,7aS)-N,N,3a-trimethyl-5,6,7,7a-tetrahydro-4H-1,3-benzoxazol-2-amine.
| Compound Name | (3aR,7aS)-N,N,3a-trimethyl-5,6,7,7a-tetrahydro-4H-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 15112124 |
| Molecular Formula | C10H18N2O |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.14 |
| IUPAC Name | (3aR,7aS)-N,N,3a-trimethyl-5,6,7,7a-tetrahydro-4H-1,3-benzoxazol-2-amine |
| SMILES | CN(C)C1=N[C@]2(C)CCCC[C@@H]2O1 |
| InChI | InChI=1S/C10H18N2O/c1-10-7-5-4-6-8(10)13-9(11-10)12(2)3/h8H,4-7H2,1-3H3/t8-,10+/m0/s1 |
| InChIKey | TVVKMYGMIMCHJA-WCBMZHEXSA-N |
| XLogP | 1.64 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |