About 3-[(E)-but-2-enyl]-1,1-dimethylurea
3-[(E)-but-2-enyl]-1,1-dimethylurea (PubChem CID 15112125) has the molecular formula C7H14N2O
and a molecular weight of 142.20 g/mol. Its IUPAC name is 3-[(E)-but-2-enyl]-1,1-dimethylurea.
Molecular Properties
| Compound Name | 3-[(E)-but-2-enyl]-1,1-dimethylurea |
| PubChem CID | 15112125 |
| Molecular Formula | C7H14N2O |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.11 |
| IUPAC Name | 3-[(E)-but-2-enyl]-1,1-dimethylurea |
| SMILES | C/C=C/CNC(=O)N(C)C |
| InChI | InChI=1S/C7H14N2O/c1-4-5-6-8-7(10)9(2)3/h4-5H,6H2,1-3H3,(H,8,10)/b5-4+ |
| InChIKey | OJBGYLXEAAKHAC-SNAWJCMRSA-N |
| XLogP | 0.83 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-[(E)-but-2-enyl]-1,1-dimethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(E)-but-2-enyl]-1,1-dimethylurea?
The IUPAC name of 3-[(E)-but-2-enyl]-1,1-dimethylurea (CID 15112125) is 3-[(E)-but-2-enyl]-1,1-dimethylurea.
What is the SMILES notation for 3-[(E)-but-2-enyl]-1,1-dimethylurea?
The canonical SMILES for 3-[(E)-but-2-enyl]-1,1-dimethylurea is C/C=C/CNC(=O)N(C)C.
What is the InChIKey of 3-[(E)-but-2-enyl]-1,1-dimethylurea?
The InChIKey is OJBGYLXEAAKHAC-SNAWJCMRSA-N. The full InChI is InChI=1S/C7H14N2O/c1-4-5-6-8-7(10)9(2)3/h4-5H,6H2,1-3H3,(H,8,10)/b5-4+.
What are the key properties of 3-[(E)-but-2-enyl]-1,1-dimethylurea?
3-[(E)-but-2-enyl]-1,1-dimethylurea has a molecular weight of 142.20 g/mol, XLogP of 0.83, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(E)-but-2-enyl]-1,1-dimethylurea is sourced from PubChem (CID 15112125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).