About 3-cyclohex-2-en-1-yl-1,1-dimethylurea
3-cyclohex-2-en-1-yl-1,1-dimethylurea (PubChem CID 15112130) has the molecular formula C9H16N2O
and a molecular weight of 168.24 g/mol. Its IUPAC name is 3-cyclohex-2-en-1-yl-1,1-dimethylurea.
Molecular Properties
| Compound Name | 3-cyclohex-2-en-1-yl-1,1-dimethylurea |
| PubChem CID | 15112130 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | 3-cyclohex-2-en-1-yl-1,1-dimethylurea |
| SMILES | CN(C)C(=O)NC1C=CCCC1 |
| InChI | InChI=1S/C9H16N2O/c1-11(2)9(12)10-8-6-4-3-5-7-8/h4,6,8H,3,5,7H2,1-2H3,(H,10,12) |
| InChIKey | ZNXNAIYDFJJLAN-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-cyclohex-2-en-1-yl-1,1-dimethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohex-2-en-1-yl-1,1-dimethylurea?
The IUPAC name of 3-cyclohex-2-en-1-yl-1,1-dimethylurea (CID 15112130) is 3-cyclohex-2-en-1-yl-1,1-dimethylurea.
What is the SMILES notation for 3-cyclohex-2-en-1-yl-1,1-dimethylurea?
The canonical SMILES for 3-cyclohex-2-en-1-yl-1,1-dimethylurea is CN(C)C(=O)NC1C=CCCC1.
What is the InChIKey of 3-cyclohex-2-en-1-yl-1,1-dimethylurea?
The InChIKey is ZNXNAIYDFJJLAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2O/c1-11(2)9(12)10-8-6-4-3-5-7-8/h4,6,8H,3,5,7H2,1-2H3,(H,10,12).
What are the key properties of 3-cyclohex-2-en-1-yl-1,1-dimethylurea?
3-cyclohex-2-en-1-yl-1,1-dimethylurea has a molecular weight of 168.24 g/mol, XLogP of 1.37, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohex-2-en-1-yl-1,1-dimethylurea is sourced from PubChem (CID 15112130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).