C22H28Cl2N4O2S — CID 151124391
1-[7-(2,4-dichlorophenyl)sulfinyl-1-methoxyheptan-2-yl]-6,7-dimethylimidazo[4,5-c]pyridin-4-amine (PubChem CID 151124391) has the molecular formula C22H28Cl2N4O2S and a molecular weight of 483.47 g/mol. Its IUPAC name is 1-[7-(2,4-dichlorophenyl)sulfinyl-1-methoxyheptan-2-yl]-6,7-dimethylimidazo[4,5-c]pyridin-4-amine.
| Compound Name | 1-[7-(2,4-dichlorophenyl)sulfinyl-1-methoxyheptan-2-yl]-6,7-dimethylimidazo[4,5-c]pyridin-4-amine |
|---|---|
| PubChem CID | 151124391 |
| Molecular Formula | C22H28Cl2N4O2S |
| Molecular Weight | 483.47 g/mol |
| Exact Mass | 482.13 |
| IUPAC Name | 1-[7-(2,4-dichlorophenyl)sulfinyl-1-methoxyheptan-2-yl]-6,7-dimethylimidazo[4,5-c]pyridin-4-amine |
| SMILES | COCC(CCCCCS(=O)c1ccc(Cl)cc1Cl)n1cnc2c(N)nc(C)c(C)c21 |
| InChI | InChI=1S/C22H28Cl2N4O2S/c1-14-15(2)27-22(25)20-21(14)28(13-26-20)17(12-30-3)7-5-4-6-10-31(29)19-9-8-16(23)11-18(19)24/h8-9,11,13,17H,4-7,10,12H2,1-3H3,(H2,25,27) |
| InChIKey | MSWLAIYVJFIFNU-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.47 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|