About 5-methylsulfinyl-1,3-thiazole
5-methylsulfinyl-1,3-thiazole (PubChem CID 151128597) has the molecular formula C4H5NOS2
and a molecular weight of 147.22 g/mol. Its IUPAC name is 5-methylsulfinyl-1,3-thiazole.
Molecular Properties
| Compound Name | 5-methylsulfinyl-1,3-thiazole |
| PubChem CID | 151128597 |
| Molecular Formula | C4H5NOS2 |
| Molecular Weight | 147.22 g/mol |
| Exact Mass | 146.98 |
| IUPAC Name | 5-methylsulfinyl-1,3-thiazole |
| SMILES | CS(=O)c1cncs1 |
| InChI | InChI=1S/C4H5NOS2/c1-8(6)4-2-5-3-7-4/h2-3H,1H3 |
| InChIKey | MTSKDSHRIYPMKC-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.22 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-methylsulfinyl-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylsulfinyl-1,3-thiazole?
The IUPAC name of 5-methylsulfinyl-1,3-thiazole (CID 151128597) is 5-methylsulfinyl-1,3-thiazole.
What is the SMILES notation for 5-methylsulfinyl-1,3-thiazole?
The canonical SMILES for 5-methylsulfinyl-1,3-thiazole is CS(=O)c1cncs1.
What is the InChIKey of 5-methylsulfinyl-1,3-thiazole?
The InChIKey is MTSKDSHRIYPMKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5NOS2/c1-8(6)4-2-5-3-7-4/h2-3H,1H3.
What are the key properties of 5-methylsulfinyl-1,3-thiazole?
5-methylsulfinyl-1,3-thiazole has a molecular weight of 147.22 g/mol, XLogP of 0.88, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylsulfinyl-1,3-thiazole is sourced from PubChem (CID 151128597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).