About 3-(2-methylprop-2-enyl)-1,1-dipropylthiourea
3-(2-methylprop-2-enyl)-1,1-dipropylthiourea (PubChem CID 15113020) has the molecular formula C11H22N2S
and a molecular weight of 214.38 g/mol. Its IUPAC name is 3-(2-methylprop-2-enyl)-1,1-dipropylthiourea.
Molecular Properties
| Compound Name | 3-(2-methylprop-2-enyl)-1,1-dipropylthiourea |
| PubChem CID | 15113020 |
| Molecular Formula | C11H22N2S |
| Molecular Weight | 214.38 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | 3-(2-methylprop-2-enyl)-1,1-dipropylthiourea |
| SMILES | C=C(C)CNC(=S)N(CCC)CCC |
| InChI | InChI=1S/C11H22N2S/c1-5-7-13(8-6-2)11(14)12-9-10(3)4/h3,5-9H2,1-2,4H3,(H,12,14) |
| InChIKey | WZPUQCNRPFQDJM-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.38 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-methylprop-2-enyl)-1,1-dipropylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-methylprop-2-enyl)-1,1-dipropylthiourea?
The IUPAC name of 3-(2-methylprop-2-enyl)-1,1-dipropylthiourea (CID 15113020) is 3-(2-methylprop-2-enyl)-1,1-dipropylthiourea.
What is the SMILES notation for 3-(2-methylprop-2-enyl)-1,1-dipropylthiourea?
The canonical SMILES for 3-(2-methylprop-2-enyl)-1,1-dipropylthiourea is C=C(C)CNC(=S)N(CCC)CCC.
What is the InChIKey of 3-(2-methylprop-2-enyl)-1,1-dipropylthiourea?
The InChIKey is WZPUQCNRPFQDJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2S/c1-5-7-13(8-6-2)11(14)12-9-10(3)4/h3,5-9H2,1-2,4H3,(H,12,14).
What are the key properties of 3-(2-methylprop-2-enyl)-1,1-dipropylthiourea?
3-(2-methylprop-2-enyl)-1,1-dipropylthiourea has a molecular weight of 214.38 g/mol, XLogP of 2.56, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-methylprop-2-enyl)-1,1-dipropylthiourea is sourced from PubChem (CID 15113020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).