C15H12ClF3N2O2S2 — CID 151132916
N-[(4-chlorophenyl)methyl]-1-[2-(3,4,4-trifluorobut-3-enylsulfinyl)-1,3-thiazol-5-yl]methanimine oxide (PubChem CID 151132916) has the molecular formula C15H12ClF3N2O2S2 and a molecular weight of 408.85 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-1-[2-(3,4,4-trifluorobut-3-enylsulfinyl)-1,3-thiazol-5-yl]methanimine oxide.
| Compound Name | N-[(4-chlorophenyl)methyl]-1-[2-(3,4,4-trifluorobut-3-enylsulfinyl)-1,3-thiazol-5-yl]methanimine oxide |
|---|---|
| PubChem CID | 151132916 |
| Molecular Formula | C15H12ClF3N2O2S2 |
| Molecular Weight | 408.85 g/mol |
| Exact Mass | 408.00 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-1-[2-(3,4,4-trifluorobut-3-enylsulfinyl)-1,3-thiazol-5-yl]methanimine oxide |
| SMILES | O=S(CCC(F)=C(F)F)c1ncc(/C=[N+](\[O-])Cc2ccc(Cl)cc2)s1 |
| InChI | InChI=1S/C15H12ClF3N2O2S2/c16-11-3-1-10(2-4-11)8-21(22)9-12-7-20-15(24-12)25(23)6-5-13(17)14(18)19/h1-4,7,9H,5-6,8H2/b21-9- |
| InChIKey | MUPLINHWSRKRLN-NKVSQWTQSA-N |
| XLogP | 4.50 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.85 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|