C10H19N3O6 — CID 151133145
tert-butyl N-(ethoxycarbonylamino)-N-(methoxycarbonylamino)carbamate (PubChem CID 151133145) has the molecular formula C10H19N3O6 and a molecular weight of 277.28 g/mol. Its IUPAC name is tert-butyl N-(ethoxycarbonylamino)-N-(methoxycarbonylamino)carbamate.
| Compound Name | tert-butyl N-(ethoxycarbonylamino)-N-(methoxycarbonylamino)carbamate |
|---|---|
| PubChem CID | 151133145 |
| Molecular Formula | C10H19N3O6 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | tert-butyl N-(ethoxycarbonylamino)-N-(methoxycarbonylamino)carbamate |
| SMILES | CCOC(=O)NN(NC(=O)OC)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H19N3O6/c1-6-18-8(15)12-13(11-7(14)17-5)9(16)19-10(2,3)4/h6H2,1-5H3,(H,11,14)(H,12,15) |
| InChIKey | MUQPBLNYPJQTMS-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|