C11H6F16 — CID 151133152
1,1,2,3,4,4,5,6,6,7,8,8,10-tridecafluoro-7-(trifluoromethyl)dec-1-ene (PubChem CID 151133152) has the molecular formula C11H6F16 and a molecular weight of 442.14 g/mol. Its IUPAC name is 1,1,2,3,4,4,5,6,6,7,8,8,10-tridecafluoro-7-(trifluoromethyl)dec-1-ene.
| Compound Name | 1,1,2,3,4,4,5,6,6,7,8,8,10-tridecafluoro-7-(trifluoromethyl)dec-1-ene |
|---|---|
| PubChem CID | 151133152 |
| Molecular Formula | C11H6F16 |
| Molecular Weight | 442.14 g/mol |
| Exact Mass | 442.02 |
| IUPAC Name | 1,1,2,3,4,4,5,6,6,7,8,8,10-tridecafluoro-7-(trifluoromethyl)dec-1-ene |
| SMILES | FCCC(F)(F)C(F)(C(F)(F)F)C(F)(F)C(F)C(F)(F)C(F)C(F)=C(F)F |
| InChI | InChI=1S/C11H6F16/c12-2-1-7(18,19)10(24,11(25,26)27)9(22,23)6(17)8(20,21)4(14)3(13)5(15)16/h4,6H,1-2H2 |
| InChIKey | MUQPXAYDPDBQSS-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.14 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |