About 3-[3-(2,2,3-triethoxyoxan-3-yl)propoxy]prop-2-ene-1-thiol
3-[3-(2,2,3-triethoxyoxan-3-yl)propoxy]prop-2-ene-1-thiol (PubChem CID 151134395) has the molecular formula C17H32O5S
and a molecular weight of 348.51 g/mol. Its IUPAC name is 3-[3-(2,2,3-triethoxyoxan-3-yl)propoxy]prop-2-ene-1-thiol.
Molecular Properties
| Compound Name | 3-[3-(2,2,3-triethoxyoxan-3-yl)propoxy]prop-2-ene-1-thiol |
| PubChem CID | 151134395 |
| Molecular Formula | C17H32O5S |
| Molecular Weight | 348.51 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | 3-[3-(2,2,3-triethoxyoxan-3-yl)propoxy]prop-2-ene-1-thiol |
| SMILES | CCOC1(CCCOC=CCS)CCCOC1(OCC)OCC |
| InChI | InChI=1S/C17H32O5S/c1-4-19-16(10-7-12-18-13-9-15-23)11-8-14-22-17(16,20-5-2)21-6-3/h9,13,23H,4-8,10-12,14-15H2,1-3H3 |
| InChIKey | MUXAXOLERPOUHI-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 46.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.51 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3-[3-(2,2,3-triethoxyoxan-3-yl)propoxy]prop-2-ene-1-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-(2,2,3-triethoxyoxan-3-yl)propoxy]prop-2-ene-1-thiol?
The IUPAC name of 3-[3-(2,2,3-triethoxyoxan-3-yl)propoxy]prop-2-ene-1-thiol (CID 151134395) is 3-[3-(2,2,3-triethoxyoxan-3-yl)propoxy]prop-2-ene-1-thiol.
What is the SMILES notation for 3-[3-(2,2,3-triethoxyoxan-3-yl)propoxy]prop-2-ene-1-thiol?
The canonical SMILES for 3-[3-(2,2,3-triethoxyoxan-3-yl)propoxy]prop-2-ene-1-thiol is CCOC1(CCCOC=CCS)CCCOC1(OCC)OCC.
What is the InChIKey of 3-[3-(2,2,3-triethoxyoxan-3-yl)propoxy]prop-2-ene-1-thiol?
The InChIKey is MUXAXOLERPOUHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H32O5S/c1-4-19-16(10-7-12-18-13-9-15-23)11-8-14-22-17(16,20-5-2)21-6-3/h9,13,23H,4-8,10-12,14-15H2,1-3H3.
What are the key properties of 3-[3-(2,2,3-triethoxyoxan-3-yl)propoxy]prop-2-ene-1-thiol?
3-[3-(2,2,3-triethoxyoxan-3-yl)propoxy]prop-2-ene-1-thiol has a molecular weight of 348.51 g/mol, XLogP of 3.54, 12 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(2,2,3-triethoxyoxan-3-yl)propoxy]prop-2-ene-1-thiol is sourced from PubChem (CID 151134395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).