About ethyl 1-(2-methoxyphenyl)-5,7-dimethyl-4-(2-phenylethynyl)phthalazine-6-carboxylate
ethyl 1-(2-methoxyphenyl)-5,7-dimethyl-4-(2-phenylethynyl)phthalazine-6-carboxylate (PubChem CID 15113461) has the molecular formula C28H24N2O3
and a molecular weight of 436.51 g/mol. Its IUPAC name is ethyl 1-(2-methoxyphenyl)-5,7-dimethyl-4-(2-phenylethynyl)phthalazine-6-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-(2-methoxyphenyl)-5,7-dimethyl-4-(2-phenylethynyl)phthalazine-6-carboxylate |
| PubChem CID | 15113461 |
| Molecular Formula | C28H24N2O3 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | ethyl 1-(2-methoxyphenyl)-5,7-dimethyl-4-(2-phenylethynyl)phthalazine-6-carboxylate |
| SMILES | CCOC(=O)c1c(C)cc2c(-c3ccccc3OC)nnc(C#Cc3ccccc3)c2c1C |
| InChI | InChI=1S/C28H24N2O3/c1-5-33-28(31)25-18(2)17-22-26(19(25)3)23(16-15-20-11-7-6-8-12-20)29-30-27(22)21-13-9-10-14-24(21)32-4/h6-14,17H,5H2,1-4H3 |
| InChIKey | BLPDCGMDFBLKBG-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl 1-(2-methoxyphenyl)-5,7-dimethyl-4-(2-phenylethynyl)phthalazine-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-(2-methoxyphenyl)-5,7-dimethyl-4-(2-phenylethynyl)phthalazine-6-carboxylate?
The IUPAC name of ethyl 1-(2-methoxyphenyl)-5,7-dimethyl-4-(2-phenylethynyl)phthalazine-6-carboxylate (CID 15113461) is ethyl 1-(2-methoxyphenyl)-5,7-dimethyl-4-(2-phenylethynyl)phthalazine-6-carboxylate.
What is the SMILES notation for ethyl 1-(2-methoxyphenyl)-5,7-dimethyl-4-(2-phenylethynyl)phthalazine-6-carboxylate?
The canonical SMILES for ethyl 1-(2-methoxyphenyl)-5,7-dimethyl-4-(2-phenylethynyl)phthalazine-6-carboxylate is CCOC(=O)c1c(C)cc2c(-c3ccccc3OC)nnc(C#Cc3ccccc3)c2c1C.
What is the InChIKey of ethyl 1-(2-methoxyphenyl)-5,7-dimethyl-4-(2-phenylethynyl)phthalazine-6-carboxylate?
The InChIKey is BLPDCGMDFBLKBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H24N2O3/c1-5-33-28(31)25-18(2)17-22-26(19(25)3)23(16-15-20-11-7-6-8-12-20)29-30-27(22)21-13-9-10-14-24(21)32-4/h6-14,17H,5H2,1-4H3.
What are the key properties of ethyl 1-(2-methoxyphenyl)-5,7-dimethyl-4-(2-phenylethynyl)phthalazine-6-carboxylate?
ethyl 1-(2-methoxyphenyl)-5,7-dimethyl-4-(2-phenylethynyl)phthalazine-6-carboxylate has a molecular weight of 436.51 g/mol, XLogP of 5.50, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-(2-methoxyphenyl)-5,7-dimethyl-4-(2-phenylethynyl)phthalazine-6-carboxylate is sourced from PubChem (CID 15113461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).