C28H24N2O3 — CID 15113461
ethyl 1-(2-methoxyphenyl)-5,7-dimethyl-4-(2-phenylethynyl)phthalazine-6-carboxylate (PubChem CID 15113461) has the molecular formula C28H24N2O3 and a molecular weight of 436.51 g/mol. Its IUPAC name is ethyl 1-(2-methoxyphenyl)-5,7-dimethyl-4-(2-phenylethynyl)phthalazine-6-carboxylate.
| Compound Name | ethyl 1-(2-methoxyphenyl)-5,7-dimethyl-4-(2-phenylethynyl)phthalazine-6-carboxylate |
|---|---|
| PubChem CID | 15113461 |
| Molecular Formula | C28H24N2O3 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | ethyl 1-(2-methoxyphenyl)-5,7-dimethyl-4-(2-phenylethynyl)phthalazine-6-carboxylate |
| SMILES | CCOC(=O)c1c(C)cc2c(-c3ccccc3OC)nnc(C#Cc3ccccc3)c2c1C |
| InChI | InChI=1S/C28H24N2O3/c1-5-33-28(31)25-18(2)17-22-26(19(25)3)23(16-15-20-11-7-6-8-12-20)29-30-27(22)21-13-9-10-14-24(21)32-4/h6-14,17H,5H2,1-4H3 |
| InChIKey | BLPDCGMDFBLKBG-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|