About trans-(1S,2R)-1-(dimethylamino)cyclobutane-1,2-diol
trans-(1S,2R)-1-(dimethylamino)cyclobutane-1,2-diol (PubChem CID 151135809) has the molecular formula C6H13NO2
and a molecular weight of 131.17 g/mol. Its IUPAC name is trans-(1S,2R)-1-(dimethylamino)cyclobutane-1,2-diol.
Molecular Properties
| Compound Name | trans-(1S,2R)-1-(dimethylamino)cyclobutane-1,2-diol |
| PubChem CID | 151135809 |
| Molecular Formula | C6H13NO2 |
| Molecular Weight | 131.17 g/mol |
| Exact Mass | 131.09 |
| IUPAC Name | trans-(1S,2R)-1-(dimethylamino)cyclobutane-1,2-diol |
| SMILES | CN(C)[C@]1(O)CC[C@H]1O |
| InChI | InChI=1S/C6H13NO2/c1-7(2)6(9)4-3-5(6)8/h5,8-9H,3-4H2,1-2H3/t5-,6+/m1/s1 |
| InChIKey | MVEMMOMAJSNFAX-RITPCOANSA-N |
| XLogP | -0.61 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.17 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze trans-(1S,2R)-1-(dimethylamino)cyclobutane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1S,2R)-1-(dimethylamino)cyclobutane-1,2-diol?
The IUPAC name of trans-(1S,2R)-1-(dimethylamino)cyclobutane-1,2-diol (CID 151135809) is trans-(1S,2R)-1-(dimethylamino)cyclobutane-1,2-diol.
What is the SMILES notation for trans-(1S,2R)-1-(dimethylamino)cyclobutane-1,2-diol?
The canonical SMILES for trans-(1S,2R)-1-(dimethylamino)cyclobutane-1,2-diol is CN(C)[C@]1(O)CC[C@H]1O.
What is the InChIKey of trans-(1S,2R)-1-(dimethylamino)cyclobutane-1,2-diol?
The InChIKey is MVEMMOMAJSNFAX-RITPCOANSA-N. The full InChI is InChI=1S/C6H13NO2/c1-7(2)6(9)4-3-5(6)8/h5,8-9H,3-4H2,1-2H3/t5-,6+/m1/s1.
What are the key properties of trans-(1S,2R)-1-(dimethylamino)cyclobutane-1,2-diol?
trans-(1S,2R)-1-(dimethylamino)cyclobutane-1,2-diol has a molecular weight of 131.17 g/mol, XLogP of -0.61, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1S,2R)-1-(dimethylamino)cyclobutane-1,2-diol is sourced from PubChem (CID 151135809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).