C18H19F3N5O4- — CID 151137407
[4-[2-(6-nitrospiro[3H-imidazo[2,1-b][1,3]oxazole-2,4'-piperidine]-1'-yl)-2-oxoethyl]-4-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]azanide (PubChem CID 151137407) has the molecular formula C18H19F3N5O4- and a molecular weight of 426.38 g/mol. Its IUPAC name is [4-[2-(6-nitrospiro[3H-imidazo[2,1-b][1,3]oxazole-2,4'-piperidine]-1'-yl)-2-oxoethyl]-4-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]azanide.
| Compound Name | [4-[2-(6-nitrospiro[3H-imidazo[2,1-b][1,3]oxazole-2,4'-piperidine]-1'-yl)-2-oxoethyl]-4-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]azanide |
|---|---|
| PubChem CID | 151137407 |
| Molecular Formula | C18H19F3N5O4- |
| Molecular Weight | 426.38 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | [4-[2-(6-nitrospiro[3H-imidazo[2,1-b][1,3]oxazole-2,4'-piperidine]-1'-yl)-2-oxoethyl]-4-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]azanide |
| SMILES | [NH-]C1=CCC(CC(=O)N2CCC3(CC2)Cn2cc([N+](=O)[O-])nc2O3)(C(F)(F)F)C=C1 |
| InChI | InChI=1S/C18H19F3N5O4/c19-18(20,21)16(3-1-12(22)2-4-16)9-14(27)24-7-5-17(6-8-24)11-25-10-13(26(28)29)23-15(25)30-17/h1-3,10,22H,4-9,11H2/q-1 |
| InChIKey | MVMFYKDXWYDEGU-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 114.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.38 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|