About tert-butyl 4-[(5-sulfamoyl-1,3-thiazol-2-yl)sulfonyl]piperidine-1-carboxylate
tert-butyl 4-[(5-sulfamoyl-1,3-thiazol-2-yl)sulfonyl]piperidine-1-carboxylate (PubChem CID 151137736) has the molecular formula C13H21N3O6S3
and a molecular weight of 411.53 g/mol. Its IUPAC name is tert-butyl 4-[(5-sulfamoyl-1,3-thiazol-2-yl)sulfonyl]piperidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 4-[(5-sulfamoyl-1,3-thiazol-2-yl)sulfonyl]piperidine-1-carboxylate |
| PubChem CID | 151137736 |
| Molecular Formula | C13H21N3O6S3 |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.06 |
| IUPAC Name | tert-butyl 4-[(5-sulfamoyl-1,3-thiazol-2-yl)sulfonyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(S(=O)(=O)c2ncc(S(N)(=O)=O)s2)CC1 |
| InChI | InChI=1S/C13H21N3O6S3/c1-13(2,3)22-12(17)16-6-4-9(5-7-16)24(18,19)11-15-8-10(23-11)25(14,20)21/h8-9H,4-7H2,1-3H3,(H2,14,20,21) |
| InChIKey | MVNWJQJYFSRGFY-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 136.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze tert-butyl 4-[(5-sulfamoyl-1,3-thiazol-2-yl)sulfonyl]piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-[(5-sulfamoyl-1,3-thiazol-2-yl)sulfonyl]piperidine-1-carboxylate?
The IUPAC name of tert-butyl 4-[(5-sulfamoyl-1,3-thiazol-2-yl)sulfonyl]piperidine-1-carboxylate (CID 151137736) is tert-butyl 4-[(5-sulfamoyl-1,3-thiazol-2-yl)sulfonyl]piperidine-1-carboxylate.
What is the SMILES notation for tert-butyl 4-[(5-sulfamoyl-1,3-thiazol-2-yl)sulfonyl]piperidine-1-carboxylate?
The canonical SMILES for tert-butyl 4-[(5-sulfamoyl-1,3-thiazol-2-yl)sulfonyl]piperidine-1-carboxylate is CC(C)(C)OC(=O)N1CCC(S(=O)(=O)c2ncc(S(N)(=O)=O)s2)CC1.
What is the InChIKey of tert-butyl 4-[(5-sulfamoyl-1,3-thiazol-2-yl)sulfonyl]piperidine-1-carboxylate?
The InChIKey is MVNWJQJYFSRGFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N3O6S3/c1-13(2,3)22-12(17)16-6-4-9(5-7-16)24(18,19)11-15-8-10(23-11)25(14,20)21/h8-9H,4-7H2,1-3H3,(H2,14,20,21).
What are the key properties of tert-butyl 4-[(5-sulfamoyl-1,3-thiazol-2-yl)sulfonyl]piperidine-1-carboxylate?
tert-butyl 4-[(5-sulfamoyl-1,3-thiazol-2-yl)sulfonyl]piperidine-1-carboxylate has a molecular weight of 411.53 g/mol, XLogP of 0.96, 3 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-[(5-sulfamoyl-1,3-thiazol-2-yl)sulfonyl]piperidine-1-carboxylate is sourced from PubChem (CID 151137736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).