C14H17F3N8 — CID 151138102
2-N-(4,4-difluorocyclohexyl)-6-(3-fluoro-6-hydrazinyl-2-pyridinyl)-1,3,5-triazine-2,4-diamine (PubChem CID 151138102) has the molecular formula C14H17F3N8 and a molecular weight of 354.34 g/mol. Its IUPAC name is 2-N-(4,4-difluorocyclohexyl)-6-(3-fluoro-6-hydrazinyl-2-pyridinyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-(4,4-difluorocyclohexyl)-6-(3-fluoro-6-hydrazinyl-2-pyridinyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 151138102 |
| Molecular Formula | C14H17F3N8 |
| Molecular Weight | 354.34 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | 2-N-(4,4-difluorocyclohexyl)-6-(3-fluoro-6-hydrazinyl-2-pyridinyl)-1,3,5-triazine-2,4-diamine |
| SMILES | NNc1ccc(F)c(-c2nc(N)nc(NC3CCC(F)(F)CC3)n2)n1 |
| InChI | InChI=1S/C14H17F3N8/c15-8-1-2-9(25-19)21-10(8)11-22-12(18)24-13(23-11)20-7-3-5-14(16,17)6-4-7/h1-2,7H,3-6,19H2,(H,21,25)(H3,18,20,22,23,24) |
| InChIKey | MVPSYOCQKWPEAH-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 127.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.34 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|