C12H10F3N3O2 — CID 151139228
2-amino-5-(2-methylpyrazol-3-yl)-4-(trifluoromethyl)benzoic acid (PubChem CID 151139228) has the molecular formula C12H10F3N3O2 and a molecular weight of 285.23 g/mol. Its IUPAC name is 2-amino-5-(2-methylpyrazol-3-yl)-4-(trifluoromethyl)benzoic acid.
| Compound Name | 2-amino-5-(2-methylpyrazol-3-yl)-4-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 151139228 |
| Molecular Formula | C12H10F3N3O2 |
| Molecular Weight | 285.23 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | 2-amino-5-(2-methylpyrazol-3-yl)-4-(trifluoromethyl)benzoic acid |
| SMILES | Cn1nccc1-c1cc(C(=O)O)c(N)cc1C(F)(F)F |
| InChI | InChI=1S/C12H10F3N3O2/c1-18-10(2-3-17-18)6-4-7(11(19)20)9(16)5-8(6)12(13,14)15/h2-5H,16H2,1H3,(H,19,20) |
| InChIKey | MVVLCCABIXDTFO-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.23 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|