About 5-(3,5-dichlorophenyl)-4-(trifluoromethyl)-3,4-dihydro-2H-pyrrole
5-(3,5-dichlorophenyl)-4-(trifluoromethyl)-3,4-dihydro-2H-pyrrole (PubChem CID 151141890) has the molecular formula C11H8Cl2F3N
and a molecular weight of 282.09 g/mol. Its IUPAC name is 5-(3,5-dichlorophenyl)-4-(trifluoromethyl)-3,4-dihydro-2H-pyrrole.
Molecular Properties
| Compound Name | 5-(3,5-dichlorophenyl)-4-(trifluoromethyl)-3,4-dihydro-2H-pyrrole |
| PubChem CID | 151141890 |
| Molecular Formula | C11H8Cl2F3N |
| Molecular Weight | 282.09 g/mol |
| Exact Mass | 281.00 |
| IUPAC Name | 5-(3,5-dichlorophenyl)-4-(trifluoromethyl)-3,4-dihydro-2H-pyrrole |
| SMILES | FC(F)(F)C1CCN=C1c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C11H8Cl2F3N/c12-7-3-6(4-8(13)5-7)10-9(1-2-17-10)11(14,15)16/h3-5,9H,1-2H2 |
| InChIKey | MWJKTPYMPLHYCQ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.09 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-(3,5-dichlorophenyl)-4-(trifluoromethyl)-3,4-dihydro-2H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,5-dichlorophenyl)-4-(trifluoromethyl)-3,4-dihydro-2H-pyrrole?
The IUPAC name of 5-(3,5-dichlorophenyl)-4-(trifluoromethyl)-3,4-dihydro-2H-pyrrole (CID 151141890) is 5-(3,5-dichlorophenyl)-4-(trifluoromethyl)-3,4-dihydro-2H-pyrrole.
What is the SMILES notation for 5-(3,5-dichlorophenyl)-4-(trifluoromethyl)-3,4-dihydro-2H-pyrrole?
The canonical SMILES for 5-(3,5-dichlorophenyl)-4-(trifluoromethyl)-3,4-dihydro-2H-pyrrole is FC(F)(F)C1CCN=C1c1cc(Cl)cc(Cl)c1.
What is the InChIKey of 5-(3,5-dichlorophenyl)-4-(trifluoromethyl)-3,4-dihydro-2H-pyrrole?
The InChIKey is MWJKTPYMPLHYCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8Cl2F3N/c12-7-3-6(4-8(13)5-7)10-9(1-2-17-10)11(14,15)16/h3-5,9H,1-2H2.
What are the key properties of 5-(3,5-dichlorophenyl)-4-(trifluoromethyl)-3,4-dihydro-2H-pyrrole?
5-(3,5-dichlorophenyl)-4-(trifluoromethyl)-3,4-dihydro-2H-pyrrole has a molecular weight of 282.09 g/mol, XLogP of 4.36, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,5-dichlorophenyl)-4-(trifluoromethyl)-3,4-dihydro-2H-pyrrole is sourced from PubChem (CID 151141890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).