About [6-(dimethylamino)-2,3-dimethyl-4-pyridinyl]methyl-methylcarbamic acid
[6-(dimethylamino)-2,3-dimethyl-4-pyridinyl]methyl-methylcarbamic acid (PubChem CID 151142010) has the molecular formula C12H19N3O2
and a molecular weight of 237.30 g/mol. Its IUPAC name is [6-(dimethylamino)-2,3-dimethyl-4-pyridinyl]methyl-methylcarbamic acid.
Molecular Properties
| Compound Name | [6-(dimethylamino)-2,3-dimethyl-4-pyridinyl]methyl-methylcarbamic acid |
| PubChem CID | 151142010 |
| Molecular Formula | C12H19N3O2 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | [6-(dimethylamino)-2,3-dimethyl-4-pyridinyl]methyl-methylcarbamic acid |
| SMILES | Cc1nc(N(C)C)cc(CN(C)C(=O)O)c1C |
| InChI | InChI=1S/C12H19N3O2/c1-8-9(2)13-11(14(3)4)6-10(8)7-15(5)12(16)17/h6H,7H2,1-5H3,(H,16,17) |
| InChIKey | MWKAWTPBGGYVRL-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [6-(dimethylamino)-2,3-dimethyl-4-pyridinyl]methyl-methylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(dimethylamino)-2,3-dimethyl-4-pyridinyl]methyl-methylcarbamic acid?
The IUPAC name of [6-(dimethylamino)-2,3-dimethyl-4-pyridinyl]methyl-methylcarbamic acid (CID 151142010) is [6-(dimethylamino)-2,3-dimethyl-4-pyridinyl]methyl-methylcarbamic acid.
What is the SMILES notation for [6-(dimethylamino)-2,3-dimethyl-4-pyridinyl]methyl-methylcarbamic acid?
The canonical SMILES for [6-(dimethylamino)-2,3-dimethyl-4-pyridinyl]methyl-methylcarbamic acid is Cc1nc(N(C)C)cc(CN(C)C(=O)O)c1C.
What is the InChIKey of [6-(dimethylamino)-2,3-dimethyl-4-pyridinyl]methyl-methylcarbamic acid?
The InChIKey is MWKAWTPBGGYVRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3O2/c1-8-9(2)13-11(14(3)4)6-10(8)7-15(5)12(16)17/h6H,7H2,1-5H3,(H,16,17).
What are the key properties of [6-(dimethylamino)-2,3-dimethyl-4-pyridinyl]methyl-methylcarbamic acid?
[6-(dimethylamino)-2,3-dimethyl-4-pyridinyl]methyl-methylcarbamic acid has a molecular weight of 237.30 g/mol, XLogP of 1.87, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(dimethylamino)-2,3-dimethyl-4-pyridinyl]methyl-methylcarbamic acid is sourced from PubChem (CID 151142010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).