C18H15ClN4O4 — CID 151142994
2-[5,7-diamino-4-(1,3-benzodioxol-5-ylmethyl)-6-chloroquinazolin-2-yl]acetic acid (PubChem CID 151142994) has the molecular formula C18H15ClN4O4 and a molecular weight of 386.80 g/mol. Its IUPAC name is 2-[5,7-diamino-4-(1,3-benzodioxol-5-ylmethyl)-6-chloroquinazolin-2-yl]acetic acid.
| Compound Name | 2-[5,7-diamino-4-(1,3-benzodioxol-5-ylmethyl)-6-chloroquinazolin-2-yl]acetic acid |
|---|---|
| PubChem CID | 151142994 |
| Molecular Formula | C18H15ClN4O4 |
| Molecular Weight | 386.80 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | 2-[5,7-diamino-4-(1,3-benzodioxol-5-ylmethyl)-6-chloroquinazolin-2-yl]acetic acid |
| SMILES | Nc1cc2nc(CC(=O)O)nc(Cc3ccc4c(c3)OCO4)c2c(N)c1Cl |
| InChI | InChI=1S/C18H15ClN4O4/c19-17-9(20)5-11-16(18(17)21)10(22-14(23-11)6-15(24)25)3-8-1-2-12-13(4-8)27-7-26-12/h1-2,4-5H,3,6-7,20-21H2,(H,24,25) |
| InChIKey | MWPAOYFEYFIIBX-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 133.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.80 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|