About 4-bromo-2,6-bis(sulfanyl)benzoic acid
4-bromo-2,6-bis(sulfanyl)benzoic acid (PubChem CID 151143453) has the molecular formula C7H5BrO2S2
and a molecular weight of 265.15 g/mol. Its IUPAC name is 4-bromo-2,6-bis(sulfanyl)benzoic acid.
Molecular Properties
| Compound Name | 4-bromo-2,6-bis(sulfanyl)benzoic acid |
| PubChem CID | 151143453 |
| Molecular Formula | C7H5BrO2S2 |
| Molecular Weight | 265.15 g/mol |
| Exact Mass | 263.89 |
| IUPAC Name | 4-bromo-2,6-bis(sulfanyl)benzoic acid |
| SMILES | O=C(O)c1c(S)cc(Br)cc1S |
| InChI | InChI=1S/C7H5BrO2S2/c8-3-1-4(11)6(7(9)10)5(12)2-3/h1-2,11-12H,(H,9,10) |
| InChIKey | MWRMDNVAWPXJSP-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.15 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-2,6-bis(sulfanyl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-2,6-bis(sulfanyl)benzoic acid?
The IUPAC name of 4-bromo-2,6-bis(sulfanyl)benzoic acid (CID 151143453) is 4-bromo-2,6-bis(sulfanyl)benzoic acid.
What is the SMILES notation for 4-bromo-2,6-bis(sulfanyl)benzoic acid?
The canonical SMILES for 4-bromo-2,6-bis(sulfanyl)benzoic acid is O=C(O)c1c(S)cc(Br)cc1S.
What is the InChIKey of 4-bromo-2,6-bis(sulfanyl)benzoic acid?
The InChIKey is MWRMDNVAWPXJSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5BrO2S2/c8-3-1-4(11)6(7(9)10)5(12)2-3/h1-2,11-12H,(H,9,10).
What are the key properties of 4-bromo-2,6-bis(sulfanyl)benzoic acid?
4-bromo-2,6-bis(sulfanyl)benzoic acid has a molecular weight of 265.15 g/mol, XLogP of 2.72, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-2,6-bis(sulfanyl)benzoic acid is sourced from PubChem (CID 151143453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).