About N-[2-[1-(3,4-dihydroxybutyl)cyclohexyl]ethyl]prop-2-enamide
N-[2-[1-(3,4-dihydroxybutyl)cyclohexyl]ethyl]prop-2-enamide (PubChem CID 151144056) has the molecular formula C15H27NO3
and a molecular weight of 269.38 g/mol. Its IUPAC name is N-[2-[1-(3,4-dihydroxybutyl)cyclohexyl]ethyl]prop-2-enamide.
Molecular Properties
| Compound Name | N-[2-[1-(3,4-dihydroxybutyl)cyclohexyl]ethyl]prop-2-enamide |
| PubChem CID | 151144056 |
| Molecular Formula | C15H27NO3 |
| Molecular Weight | 269.38 g/mol |
| Exact Mass | 269.20 |
| IUPAC Name | N-[2-[1-(3,4-dihydroxybutyl)cyclohexyl]ethyl]prop-2-enamide |
| SMILES | C=CC(=O)NCCC1(CCC(O)CO)CCCCC1 |
| InChI | InChI=1S/C15H27NO3/c1-2-14(19)16-11-10-15(7-4-3-5-8-15)9-6-13(18)12-17/h2,13,17-18H,1,3-12H2,(H,16,19) |
| InChIKey | MWUVHPBIRQAWNS-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.38 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-[2-[1-(3,4-dihydroxybutyl)cyclohexyl]ethyl]prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[1-(3,4-dihydroxybutyl)cyclohexyl]ethyl]prop-2-enamide?
The IUPAC name of N-[2-[1-(3,4-dihydroxybutyl)cyclohexyl]ethyl]prop-2-enamide (CID 151144056) is N-[2-[1-(3,4-dihydroxybutyl)cyclohexyl]ethyl]prop-2-enamide.
What is the SMILES notation for N-[2-[1-(3,4-dihydroxybutyl)cyclohexyl]ethyl]prop-2-enamide?
The canonical SMILES for N-[2-[1-(3,4-dihydroxybutyl)cyclohexyl]ethyl]prop-2-enamide is C=CC(=O)NCCC1(CCC(O)CO)CCCCC1.
What is the InChIKey of N-[2-[1-(3,4-dihydroxybutyl)cyclohexyl]ethyl]prop-2-enamide?
The InChIKey is MWUVHPBIRQAWNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27NO3/c1-2-14(19)16-11-10-15(7-4-3-5-8-15)9-6-13(18)12-17/h2,13,17-18H,1,3-12H2,(H,16,19).
What are the key properties of N-[2-[1-(3,4-dihydroxybutyl)cyclohexyl]ethyl]prop-2-enamide?
N-[2-[1-(3,4-dihydroxybutyl)cyclohexyl]ethyl]prop-2-enamide has a molecular weight of 269.38 g/mol, XLogP of 1.76, 8 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[1-(3,4-dihydroxybutyl)cyclohexyl]ethyl]prop-2-enamide is sourced from PubChem (CID 151144056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).