About 3,4-dimethoxy-N-methyl-9,10-dihydrophenanthren-9-amine
3,4-dimethoxy-N-methyl-9,10-dihydrophenanthren-9-amine (PubChem CID 15114431) has the molecular formula C17H19NO2
and a molecular weight of 269.34 g/mol. Its IUPAC name is 3,4-dimethoxy-N-methyl-9,10-dihydrophenanthren-9-amine.
Molecular Properties
| Compound Name | 3,4-dimethoxy-N-methyl-9,10-dihydrophenanthren-9-amine |
| PubChem CID | 15114431 |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 3,4-dimethoxy-N-methyl-9,10-dihydrophenanthren-9-amine |
| SMILES | CNC1Cc2ccc(OC)c(OC)c2-c2ccccc21 |
| InChI | InChI=1S/C17H19NO2/c1-18-14-10-11-8-9-15(19-2)17(20-3)16(11)13-7-5-4-6-12(13)14/h4-9,14,18H,10H2,1-3H3 |
| InChIKey | MUSSAKSITKMRTG-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,4-dimethoxy-N-methyl-9,10-dihydrophenanthren-9-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dimethoxy-N-methyl-9,10-dihydrophenanthren-9-amine?
The IUPAC name of 3,4-dimethoxy-N-methyl-9,10-dihydrophenanthren-9-amine (CID 15114431) is 3,4-dimethoxy-N-methyl-9,10-dihydrophenanthren-9-amine.
What is the SMILES notation for 3,4-dimethoxy-N-methyl-9,10-dihydrophenanthren-9-amine?
The canonical SMILES for 3,4-dimethoxy-N-methyl-9,10-dihydrophenanthren-9-amine is CNC1Cc2ccc(OC)c(OC)c2-c2ccccc21.
What is the InChIKey of 3,4-dimethoxy-N-methyl-9,10-dihydrophenanthren-9-amine?
The InChIKey is MUSSAKSITKMRTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19NO2/c1-18-14-10-11-8-9-15(19-2)17(20-3)16(11)13-7-5-4-6-12(13)14/h4-9,14,18H,10H2,1-3H3.
What are the key properties of 3,4-dimethoxy-N-methyl-9,10-dihydrophenanthren-9-amine?
3,4-dimethoxy-N-methyl-9,10-dihydrophenanthren-9-amine has a molecular weight of 269.34 g/mol, XLogP of 3.19, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethoxy-N-methyl-9,10-dihydrophenanthren-9-amine is sourced from PubChem (CID 15114431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).