C15H16N4O3 — CID 151146620
5-(pyridin-4-ylmethyl)cyclohexa-1,3-diene-1,3,5-tricarboxamide (PubChem CID 151146620) has the molecular formula C15H16N4O3 and a molecular weight of 300.32 g/mol. Its IUPAC name is 5-(pyridin-4-ylmethyl)cyclohexa-1,3-diene-1,3,5-tricarboxamide.
| Compound Name | 5-(pyridin-4-ylmethyl)cyclohexa-1,3-diene-1,3,5-tricarboxamide |
|---|---|
| PubChem CID | 151146620 |
| Molecular Formula | C15H16N4O3 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | 5-(pyridin-4-ylmethyl)cyclohexa-1,3-diene-1,3,5-tricarboxamide |
| SMILES | NC(=O)C1=CC(Cc2ccncc2)(C(N)=O)CC(C(N)=O)=C1 |
| InChI | InChI=1S/C15H16N4O3/c16-12(20)10-5-11(13(17)21)8-15(7-10,14(18)22)6-9-1-3-19-4-2-9/h1-5,7H,6,8H2,(H2,16,20)(H2,17,21)(H2,18,22) |
| InChIKey | MXIHWEYGOAWYDT-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 142.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |