About 2-hydrazinyl-4,5-dihydroimidazol-1-amine
2-hydrazinyl-4,5-dihydroimidazol-1-amine (PubChem CID 15114691) has the molecular formula C3H9N5
and a molecular weight of 115.14 g/mol. Its IUPAC name is 2-hydrazinyl-4,5-dihydroimidazol-1-amine.
Molecular Properties
| Compound Name | 2-hydrazinyl-4,5-dihydroimidazol-1-amine |
| PubChem CID | 15114691 |
| Molecular Formula | C3H9N5 |
| Molecular Weight | 115.14 g/mol |
| Exact Mass | 115.09 |
| IUPAC Name | 2-hydrazinyl-4,5-dihydroimidazol-1-amine |
| SMILES | NNC1=NCCN1N |
| InChI | InChI=1S/C3H9N5/c4-7-3-6-1-2-8(3)5/h1-2,4-5H2,(H,6,7) |
| InChIKey | IWVXANFKICNORB-UHFFFAOYSA-N |
| XLogP | -2.01 |
| TPSA | 79.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.14 |
| LogP ≤ 5 | -2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-hydrazinyl-4,5-dihydroimidazol-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydrazinyl-4,5-dihydroimidazol-1-amine?
The IUPAC name of 2-hydrazinyl-4,5-dihydroimidazol-1-amine (CID 15114691) is 2-hydrazinyl-4,5-dihydroimidazol-1-amine.
What is the SMILES notation for 2-hydrazinyl-4,5-dihydroimidazol-1-amine?
The canonical SMILES for 2-hydrazinyl-4,5-dihydroimidazol-1-amine is NNC1=NCCN1N.
What is the InChIKey of 2-hydrazinyl-4,5-dihydroimidazol-1-amine?
The InChIKey is IWVXANFKICNORB-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9N5/c4-7-3-6-1-2-8(3)5/h1-2,4-5H2,(H,6,7).
What are the key properties of 2-hydrazinyl-4,5-dihydroimidazol-1-amine?
2-hydrazinyl-4,5-dihydroimidazol-1-amine has a molecular weight of 115.14 g/mol, XLogP of -2.01, 0 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydrazinyl-4,5-dihydroimidazol-1-amine is sourced from PubChem (CID 15114691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).