C36H25N5S2 — CID 151147238
2-[6-(3-thiophen-2-yl-1-tritylpyrazol-4-yl)imidazo[1,2-a]pyridin-3-yl]-1,3-thiazole (PubChem CID 151147238) has the molecular formula C36H25N5S2 and a molecular weight of 591.77 g/mol. Its IUPAC name is 2-[6-(3-thiophen-2-yl-1-tritylpyrazol-4-yl)imidazo[1,2-a]pyridin-3-yl]-1,3-thiazole.
| Compound Name | 2-[6-(3-thiophen-2-yl-1-tritylpyrazol-4-yl)imidazo[1,2-a]pyridin-3-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 151147238 |
| Molecular Formula | C36H25N5S2 |
| Molecular Weight | 591.77 g/mol |
| Exact Mass | 591.16 |
| IUPAC Name | 2-[6-(3-thiophen-2-yl-1-tritylpyrazol-4-yl)imidazo[1,2-a]pyridin-3-yl]-1,3-thiazole |
| SMILES | c1ccc(C(c2ccccc2)(c2ccccc2)n2cc(-c3ccc4ncc(-c5nccs5)n4c3)c(-c3cccs3)n2)cc1 |
| InChI | InChI=1S/C36H25N5S2/c1-4-11-27(12-5-1)36(28-13-6-2-7-14-28,29-15-8-3-9-16-29)41-25-30(34(39-41)32-17-10-21-42-32)26-18-19-33-38-23-31(40(33)24-26)35-37-20-22-43-35/h1-25H |
| InChIKey | MXLOGTGBKAECMC-UHFFFAOYSA-N |
| XLogP | 8.89 |
| TPSA | 48.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.77 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|