C10H19F2N3O — CID 151147765
5-(3,3-difluoropiperidin-1-yl)pentanehydrazide (PubChem CID 151147765) has the molecular formula C10H19F2N3O and a molecular weight of 235.28 g/mol. Its IUPAC name is 5-(3,3-difluoropiperidin-1-yl)pentanehydrazide.
| Compound Name | 5-(3,3-difluoropiperidin-1-yl)pentanehydrazide |
|---|---|
| PubChem CID | 151147765 |
| Molecular Formula | C10H19F2N3O |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.15 |
| IUPAC Name | 5-(3,3-difluoropiperidin-1-yl)pentanehydrazide |
| SMILES | NNC(=O)CCCCN1CCCC(F)(F)C1 |
| InChI | InChI=1S/C10H19F2N3O/c11-10(12)5-3-7-15(8-10)6-2-1-4-9(16)14-13/h1-8,13H2,(H,14,16) |
| InChIKey | MXOIBUXPBWUABZ-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|