About (3S,4S)-1-benzyl-3,4-bis(methoxymethoxy)pyrrolidine
(3S,4S)-1-benzyl-3,4-bis(methoxymethoxy)pyrrolidine (PubChem CID 15114850) has the molecular formula C15H23NO4
and a molecular weight of 281.35 g/mol. Its IUPAC name is (3S,4S)-1-benzyl-3,4-bis(methoxymethoxy)pyrrolidine.
Molecular Properties
| Compound Name | (3S,4S)-1-benzyl-3,4-bis(methoxymethoxy)pyrrolidine |
| PubChem CID | 15114850 |
| Molecular Formula | C15H23NO4 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | (3S,4S)-1-benzyl-3,4-bis(methoxymethoxy)pyrrolidine |
| SMILES | COCO[C@H]1CN(Cc2ccccc2)C[C@@H]1OCOC |
| InChI | InChI=1S/C15H23NO4/c1-17-11-19-14-9-16(10-15(14)20-12-18-2)8-13-6-4-3-5-7-13/h3-7,14-15H,8-12H2,1-2H3/t14-,15-/m0/s1 |
| InChIKey | AWRKWEOPBRJVQG-GJZGRUSLSA-N |
| XLogP | 1.48 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (3S,4S)-1-benzyl-3,4-bis(methoxymethoxy)pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4S)-1-benzyl-3,4-bis(methoxymethoxy)pyrrolidine?
The IUPAC name of (3S,4S)-1-benzyl-3,4-bis(methoxymethoxy)pyrrolidine (CID 15114850) is (3S,4S)-1-benzyl-3,4-bis(methoxymethoxy)pyrrolidine.
What is the SMILES notation for (3S,4S)-1-benzyl-3,4-bis(methoxymethoxy)pyrrolidine?
The canonical SMILES for (3S,4S)-1-benzyl-3,4-bis(methoxymethoxy)pyrrolidine is COCO[C@H]1CN(Cc2ccccc2)C[C@@H]1OCOC.
What is the InChIKey of (3S,4S)-1-benzyl-3,4-bis(methoxymethoxy)pyrrolidine?
The InChIKey is AWRKWEOPBRJVQG-GJZGRUSLSA-N. The full InChI is InChI=1S/C15H23NO4/c1-17-11-19-14-9-16(10-15(14)20-12-18-2)8-13-6-4-3-5-7-13/h3-7,14-15H,8-12H2,1-2H3/t14-,15-/m0/s1.
What are the key properties of (3S,4S)-1-benzyl-3,4-bis(methoxymethoxy)pyrrolidine?
(3S,4S)-1-benzyl-3,4-bis(methoxymethoxy)pyrrolidine has a molecular weight of 281.35 g/mol, XLogP of 1.48, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4S)-1-benzyl-3,4-bis(methoxymethoxy)pyrrolidine is sourced from PubChem (CID 15114850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).