C16H25NO6 — CID 15114851
(2R,3S,4S)-1-hydroxy-3,4-bis(methoxymethoxy)-2-[(4-methoxyphenyl)methyl]pyrrolidine (PubChem CID 15114851) has the molecular formula C16H25NO6 and a molecular weight of 327.38 g/mol. Its IUPAC name is (2R,3S,4S)-1-hydroxy-3,4-bis(methoxymethoxy)-2-[(4-methoxyphenyl)methyl]pyrrolidine.
| Compound Name | (2R,3S,4S)-1-hydroxy-3,4-bis(methoxymethoxy)-2-[(4-methoxyphenyl)methyl]pyrrolidine |
|---|---|
| PubChem CID | 15114851 |
| Molecular Formula | C16H25NO6 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | (2R,3S,4S)-1-hydroxy-3,4-bis(methoxymethoxy)-2-[(4-methoxyphenyl)methyl]pyrrolidine |
| SMILES | COCO[C@@H]1[C@@H](OCOC)CN(O)[C@@H]1Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C16H25NO6/c1-19-10-22-15-9-17(18)14(16(15)23-11-20-2)8-12-4-6-13(21-3)7-5-12/h4-7,14-16,18H,8-11H2,1-3H3/t14-,15+,16+/m1/s1 |
| InChIKey | CIILYJCPAOIOQT-PMPSAXMXSA-N |
| XLogP | 1.29 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|