About 4-amino-4-sulfanylcyclohexa-1,5-diene-1-sulfonamide
4-amino-4-sulfanylcyclohexa-1,5-diene-1-sulfonamide (PubChem CID 151149052) has the molecular formula C6H10N2O2S2
and a molecular weight of 206.29 g/mol. Its IUPAC name is 4-amino-4-sulfanylcyclohexa-1,5-diene-1-sulfonamide.
Molecular Properties
| Compound Name | 4-amino-4-sulfanylcyclohexa-1,5-diene-1-sulfonamide |
| PubChem CID | 151149052 |
| Molecular Formula | C6H10N2O2S2 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.02 |
| IUPAC Name | 4-amino-4-sulfanylcyclohexa-1,5-diene-1-sulfonamide |
| SMILES | NC1(S)C=CC(S(N)(=O)=O)=CC1 |
| InChI | InChI=1S/C6H10N2O2S2/c7-6(11)3-1-5(2-4-6)12(8,9)10/h1-3,11H,4,7H2,(H2,8,9,10) |
| InChIKey | MXVCTOSROVJECM-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-4-sulfanylcyclohexa-1,5-diene-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-4-sulfanylcyclohexa-1,5-diene-1-sulfonamide?
The IUPAC name of 4-amino-4-sulfanylcyclohexa-1,5-diene-1-sulfonamide (CID 151149052) is 4-amino-4-sulfanylcyclohexa-1,5-diene-1-sulfonamide.
What is the SMILES notation for 4-amino-4-sulfanylcyclohexa-1,5-diene-1-sulfonamide?
The canonical SMILES for 4-amino-4-sulfanylcyclohexa-1,5-diene-1-sulfonamide is NC1(S)C=CC(S(N)(=O)=O)=CC1.
What is the InChIKey of 4-amino-4-sulfanylcyclohexa-1,5-diene-1-sulfonamide?
The InChIKey is MXVCTOSROVJECM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2O2S2/c7-6(11)3-1-5(2-4-6)12(8,9)10/h1-3,11H,4,7H2,(H2,8,9,10).
What are the key properties of 4-amino-4-sulfanylcyclohexa-1,5-diene-1-sulfonamide?
4-amino-4-sulfanylcyclohexa-1,5-diene-1-sulfonamide has a molecular weight of 206.29 g/mol, XLogP of -0.30, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-4-sulfanylcyclohexa-1,5-diene-1-sulfonamide is sourced from PubChem (CID 151149052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).