C25H23N5O2 — CID 151150040
6-(4-methoxyphenyl)-3-(1,3,4-oxadiazol-2-yl)-N-(3-pyrrol-1-ylpropyl)quinolin-4-amine (PubChem CID 151150040) has the molecular formula C25H23N5O2 and a molecular weight of 425.49 g/mol. Its IUPAC name is 6-(4-methoxyphenyl)-3-(1,3,4-oxadiazol-2-yl)-N-(3-pyrrol-1-ylpropyl)quinolin-4-amine.
| Compound Name | 6-(4-methoxyphenyl)-3-(1,3,4-oxadiazol-2-yl)-N-(3-pyrrol-1-ylpropyl)quinolin-4-amine |
|---|---|
| PubChem CID | 151150040 |
| Molecular Formula | C25H23N5O2 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | 6-(4-methoxyphenyl)-3-(1,3,4-oxadiazol-2-yl)-N-(3-pyrrol-1-ylpropyl)quinolin-4-amine |
| SMILES | COc1ccc(-c2ccc3ncc(-c4nnco4)c(NCCCn4cccc4)c3c2)cc1 |
| InChI | InChI=1S/C25H23N5O2/c1-31-20-8-5-18(6-9-20)19-7-10-23-21(15-19)24(22(16-27-23)25-29-28-17-32-25)26-11-4-14-30-12-2-3-13-30/h2-3,5-10,12-13,15-17H,4,11,14H2,1H3,(H,26,27) |
| InChIKey | MYANQKPFWWQTRW-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 78.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|