About 4,5-dichloro-3-hydroxy-6-octoxybenzene-1,2-dicarbonitrile
4,5-dichloro-3-hydroxy-6-octoxybenzene-1,2-dicarbonitrile (PubChem CID 15115006) has the molecular formula C16H18Cl2N2O2
and a molecular weight of 341.24 g/mol. Its IUPAC name is 4,5-dichloro-3-hydroxy-6-octoxybenzene-1,2-dicarbonitrile.
Molecular Properties
| Compound Name | 4,5-dichloro-3-hydroxy-6-octoxybenzene-1,2-dicarbonitrile |
| PubChem CID | 15115006 |
| Molecular Formula | C16H18Cl2N2O2 |
| Molecular Weight | 341.24 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | 4,5-dichloro-3-hydroxy-6-octoxybenzene-1,2-dicarbonitrile |
| SMILES | CCCCCCCCOc1c(Cl)c(Cl)c(O)c(C#N)c1C#N |
| InChI | InChI=1S/C16H18Cl2N2O2/c1-2-3-4-5-6-7-8-22-16-12(10-20)11(9-19)15(21)13(17)14(16)18/h21H,2-8H2,1H3 |
| InChIKey | WXAHDCBDQQQYIR-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 341.24 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4,5-dichloro-3-hydroxy-6-octoxybenzene-1,2-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dichloro-3-hydroxy-6-octoxybenzene-1,2-dicarbonitrile?
The IUPAC name of 4,5-dichloro-3-hydroxy-6-octoxybenzene-1,2-dicarbonitrile (CID 15115006) is 4,5-dichloro-3-hydroxy-6-octoxybenzene-1,2-dicarbonitrile.
What is the SMILES notation for 4,5-dichloro-3-hydroxy-6-octoxybenzene-1,2-dicarbonitrile?
The canonical SMILES for 4,5-dichloro-3-hydroxy-6-octoxybenzene-1,2-dicarbonitrile is CCCCCCCCOc1c(Cl)c(Cl)c(O)c(C#N)c1C#N.
What is the InChIKey of 4,5-dichloro-3-hydroxy-6-octoxybenzene-1,2-dicarbonitrile?
The InChIKey is WXAHDCBDQQQYIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18Cl2N2O2/c1-2-3-4-5-6-7-8-22-16-12(10-20)11(9-19)15(21)13(17)14(16)18/h21H,2-8H2,1H3.
What are the key properties of 4,5-dichloro-3-hydroxy-6-octoxybenzene-1,2-dicarbonitrile?
4,5-dichloro-3-hydroxy-6-octoxybenzene-1,2-dicarbonitrile has a molecular weight of 341.24 g/mol, XLogP of 5.18, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dichloro-3-hydroxy-6-octoxybenzene-1,2-dicarbonitrile is sourced from PubChem (CID 15115006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).