About 3-[6-bromo-3-(2-trimethylsilylethynyl)indazol-1-yl]-2,2-dimethylpropan-1-ol
3-[6-bromo-3-(2-trimethylsilylethynyl)indazol-1-yl]-2,2-dimethylpropan-1-ol (PubChem CID 151151907) has the molecular formula C17H23BrN2OSi
and a molecular weight of 379.37 g/mol. Its IUPAC name is 3-[6-bromo-3-(2-trimethylsilylethynyl)indazol-1-yl]-2,2-dimethylpropan-1-ol.
Molecular Properties
| Compound Name | 3-[6-bromo-3-(2-trimethylsilylethynyl)indazol-1-yl]-2,2-dimethylpropan-1-ol |
| PubChem CID | 151151907 |
| Molecular Formula | C17H23BrN2OSi |
| Molecular Weight | 379.37 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | 3-[6-bromo-3-(2-trimethylsilylethynyl)indazol-1-yl]-2,2-dimethylpropan-1-ol |
| SMILES | CC(C)(CO)Cn1nc(C#C[Si](C)(C)C)c2ccc(Br)cc21 |
| InChI | InChI=1S/C17H23BrN2OSi/c1-17(2,12-21)11-20-16-10-13(18)6-7-14(16)15(19-20)8-9-22(3,4)5/h6-7,10,21H,11-12H2,1-5H3 |
| InChIKey | MYKAOLTZWTZYOA-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.37 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[6-bromo-3-(2-trimethylsilylethynyl)indazol-1-yl]-2,2-dimethylpropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[6-bromo-3-(2-trimethylsilylethynyl)indazol-1-yl]-2,2-dimethylpropan-1-ol?
The IUPAC name of 3-[6-bromo-3-(2-trimethylsilylethynyl)indazol-1-yl]-2,2-dimethylpropan-1-ol (CID 151151907) is 3-[6-bromo-3-(2-trimethylsilylethynyl)indazol-1-yl]-2,2-dimethylpropan-1-ol.
What is the SMILES notation for 3-[6-bromo-3-(2-trimethylsilylethynyl)indazol-1-yl]-2,2-dimethylpropan-1-ol?
The canonical SMILES for 3-[6-bromo-3-(2-trimethylsilylethynyl)indazol-1-yl]-2,2-dimethylpropan-1-ol is CC(C)(CO)Cn1nc(C#C[Si](C)(C)C)c2ccc(Br)cc21.
What is the InChIKey of 3-[6-bromo-3-(2-trimethylsilylethynyl)indazol-1-yl]-2,2-dimethylpropan-1-ol?
The InChIKey is MYKAOLTZWTZYOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23BrN2OSi/c1-17(2,12-21)11-20-16-10-13(18)6-7-14(16)15(19-20)8-9-22(3,4)5/h6-7,10,21H,11-12H2,1-5H3.
What are the key properties of 3-[6-bromo-3-(2-trimethylsilylethynyl)indazol-1-yl]-2,2-dimethylpropan-1-ol?
3-[6-bromo-3-(2-trimethylsilylethynyl)indazol-1-yl]-2,2-dimethylpropan-1-ol has a molecular weight of 379.37 g/mol, XLogP of 4.05, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[6-bromo-3-(2-trimethylsilylethynyl)indazol-1-yl]-2,2-dimethylpropan-1-ol is sourced from PubChem (CID 151151907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).