C21H22ClI3N2O9 — CID 15115280
2-[[3-[acetyl(2,3-diacetyloxypropyl)amino]-5-carbonochloridoyl-2,4,6-triiodobenzoyl]amino]ethyl acetate (PubChem CID 15115280) has the molecular formula C21H22ClI3N2O9 and a molecular weight of 862.58 g/mol. Its IUPAC name is 2-[[3-[acetyl(2,3-diacetyloxypropyl)amino]-5-carbonochloridoyl-2,4,6-triiodobenzoyl]amino]ethyl acetate.
| Compound Name | 2-[[3-[acetyl(2,3-diacetyloxypropyl)amino]-5-carbonochloridoyl-2,4,6-triiodobenzoyl]amino]ethyl acetate |
|---|---|
| PubChem CID | 15115280 |
| Molecular Formula | C21H22ClI3N2O9 |
| Molecular Weight | 862.58 g/mol |
| Exact Mass | 861.81 |
| IUPAC Name | 2-[[3-[acetyl(2,3-diacetyloxypropyl)amino]-5-carbonochloridoyl-2,4,6-triiodobenzoyl]amino]ethyl acetate |
| SMILES | CC(=O)OCCNC(=O)c1c(I)c(C(=O)Cl)c(I)c(N(CC(COC(C)=O)OC(C)=O)C(C)=O)c1I |
| InChI | InChI=1S/C21H22ClI3N2O9/c1-9(28)27(7-13(36-12(4)31)8-35-11(3)30)19-17(24)14(20(22)32)16(23)15(18(19)25)21(33)26-5-6-34-10(2)29/h13H,5-8H2,1-4H3,(H,26,33) |
| InChIKey | BINKSTNTQFGTPH-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 145.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 862.58 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|